CAS 1215511-11-7 is the registry number for N-Methyl-4-aminobutyric Acid-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
4-(trideuteriomethylamino)butanoic acid (CAS 1215511-11-7) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 120.16 g/mol. IUPAC name: 4-(trideuteriomethylamino)butanoic acid. InChIKey: AOKCDAVWJLOAHG-FIBGUPNXSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 120.16 g/mol |
| IUPAC name | 4-(trideuteriomethylamino)butanoic acid |
| InChIKey | AOKCDAVWJLOAHG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCCCC(=O)O |
Computed by PubChem (NCBI)