Products 1215511-11-7

CAS 1215511-11-7 is the registry number for N-Methyl-4-aminobutyric Acid-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

4-(trideuteriomethylamino)butanoic acid (CAS 1215511-11-7) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 120.16 g/mol. IUPAC name: 4-(trideuteriomethylamino)butanoic acid. InChIKey: AOKCDAVWJLOAHG-FIBGUPNXSA-N.

Identity
Molecular formulaC5H11NO2
Molecular weight120.16 g/mol
IUPAC name4-(trideuteriomethylamino)butanoic acid
InChIKeyAOKCDAVWJLOAHG-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])NCCCC(=O)O

Computed by PubChem (NCBI)