Products 1215561-37-7
CAS 1215561-37-7 appears in our catalog under these names: (R,S)-Cotinine-d3 N-Oxide, >95% (HPLC), (R,S)-Cotinine-d3 N-Oxide. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg.
5-(1-oxidopyridin-1-ium-3-yl)-1-(trideuteriomethyl)pyrrolidin-2-one (CAS 1215561-37-7) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 195.23 g/mol. IUPAC name: 5-(1-oxidopyridin-1-ium-3-yl)-1-(trideuteriomethyl)pyrrolidin-2-one. InChIKey: CIPULDKLIIVIER-FIBGUPNXSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 195.23 g/mol |
| IUPAC name | 5-(1-oxidopyridin-1-ium-3-yl)-1-(trideuteriomethyl)pyrrolidin-2-one |
| InChIKey | CIPULDKLIIVIER-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(CCC1=O)C2=C[N+](=CC=C2)[O-] |
Computed by PubChem (NCBI)