CAS 1215575-90-8 is the registry number for 1-(3-Bromobenzyl)guanidine sulfate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(3-bromophenyl)methyl]guanidine;sulfuric acid (CAS 1215575-90-8) is a chemical compound with the molecular formula C8H12BrN3O4S and a molecular weight of 326.17 g/mol. IUPAC name: 2-[(3-bromophenyl)methyl]guanidine;sulfuric acid. InChIKey: JKFZDMLFJVXWBF-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3O4S |
|---|---|
| Molecular weight | 326.17 g/mol |
| IUPAC name | 2-[(3-bromophenyl)methyl]guanidine;sulfuric acid |
| InChIKey | JKFZDMLFJVXWBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CN=C(N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)