Products 1215622-76-6
CAS 1215622-76-6 appears in our catalog under these names: 3-Hydroxyoctanoic Acid-d12, >95% (HPLC), 3-Hydroxyoctanoic acid-d12, 96.90%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
3,4,4,5,5,6,6,7,7,8,8,8-dodecadeuterio-3-hydroxyoctanoic acid (CAS 1215622-76-6) is a chemical compound with the molecular formula C8H16O3 and a molecular weight of 172.28 g/mol. IUPAC name: 3,4,4,5,5,6,6,7,7,8,8,8-dodecadeuterio-3-hydroxyoctanoic acid. InChIKey: NDPLAKGOSZHTPH-SDFLALOFSA-N.
| Molecular formula | C8H16O3 |
|---|---|
| Molecular weight | 172.28 g/mol |
| IUPAC name | 3,4,4,5,5,6,6,7,7,8,8,8-dodecadeuterio-3-hydroxyoctanoic acid |
| InChIKey | NDPLAKGOSZHTPH-SDFLALOFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])(CC(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Hydroxyoctanoic Acid-d12, orb3135121