CAS 1215629-45-0 appears in our catalog under these names: 5-Hydroxy Omeprazole Sodium Salt, 98%, 5-Hydroxy Omeprazole Sodium Salt, >95% (HPLC), 5-Hydroxy omeprazole sodium salt, 5-Hydroxy omeprazole sodium salt, 2 mg, 5-Hydroxy omeprazole sodium salt, 5 mg. Offered by: Chemat Brand, TRC, Biosynth, Roth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2,5mg, 2mg, 5mg, 50mg, 25mg.
Sodium [4-methoxy-6-[(5-methoxybenzimidazol-1-id-2-yl)sulfinylmethyl]-5-methyl-3-pyridinyl]methanol (CAS 1215629-45-0) is a chemical compound with the molecular formula C17H18N3NaO4S and a molecular weight of 383.4 g/mol. IUPAC name: sodium [4-methoxy-6-[(5-methoxybenzimidazol-1-id-2-yl)sulfinylmethyl]-5-methyl-3-pyridinyl]methanol. InChIKey: DUXRBEBEUHQJMS-UHFFFAOYSA-N.
| Molecular formula | C17H18N3NaO4S |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | sodium [4-methoxy-6-[(5-methoxybenzimidazol-1-id-2-yl)sulfinylmethyl]-5-methyl-3-pyridinyl]methanol |
| InChIKey | DUXRBEBEUHQJMS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CN=C1CS(=O)C2=NC3=C([N-]2)C=CC(=C3)OC)CO)OC.[Na+] |
Computed by PubChem (NCBI)