CAS 1215630-77-5 is the registry number for 2-Methyl-1,3-dioxolane-2-propanol-d4. Offered by: TRC. Available pack sizes: 250mg, 25mg.
1,1,2,2-tetradeuterio-3-(2-methyl-1,3-dioxolan-2-yl)propan-1-ol (CAS 1215630-77-5) is a chemical compound with the molecular formula C7H14O3 and a molecular weight of 150.21 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-3-(2-methyl-1,3-dioxolan-2-yl)propan-1-ol. InChIKey: NEPTYGVWDNDVBS-BYUTVXSXSA-N.
| Molecular formula | C7H14O3 |
|---|---|
| Molecular weight | 150.21 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-3-(2-methyl-1,3-dioxolan-2-yl)propan-1-ol |
| InChIKey | NEPTYGVWDNDVBS-BYUTVXSXSA-N |
| SMILES | [2H]C([2H])(CC1(OCCO1)C)C([2H])([2H])O |
Computed by PubChem (NCBI)