CAS 1215649-28-7 appears in our catalog under these names: Nafronyl, 95%, Nafronyl-d4, Naftidrofuryl-d4. Offered by: Combi-blocks, TRC, Biosynth, MedChemExpress. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 5mg, 10mg, 25mg.
[1,1,2,2-tetradeuterio-2-(diethylamino)ethyl] 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate (CAS 1215649-28-7) is a chemical compound with the molecular formula C24H33NO3 and a molecular weight of 387.5 g/mol. IUPAC name: [1,1,2,2-tetradeuterio-2-(diethylamino)ethyl] 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate. InChIKey: KBAFPSLPKGSANY-RCYYZLFTSA-N.
| Molecular formula | C24H33NO3 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | [1,1,2,2-tetradeuterio-2-(diethylamino)ethyl] 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate |
| InChIKey | KBAFPSLPKGSANY-RCYYZLFTSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC(=O)C(CC1CCCO1)CC2=CC=CC3=CC=CC=C32)N(CC)CC |
Computed by PubChem (NCBI)