Products 1215678-02-6
CAS 1215678-02-6 is the registry number for N10-Monodesmethyl Rizatriptan-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]-N-(trideuteriomethyl)ethanamine (CAS 1215678-02-6) is a chemical compound with the molecular formula C14H17N5 and a molecular weight of 258.34 g/mol. IUPAC name: 2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]-N-(trideuteriomethyl)ethanamine. InChIKey: HTVLSIBBGWEXCH-FIBGUPNXSA-N.
| Molecular formula | C14H17N5 |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]-N-(trideuteriomethyl)ethanamine |
| InChIKey | HTVLSIBBGWEXCH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3 |
Computed by PubChem (NCBI)