Products 1215683-02-5
CAS 1215683-02-5 is the registry number for 7-Hydroxycoumarin sulfate-d5. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(3,4,5,6,8-pentadeuterio-2-oxochromen-7-yl) hydrogen sulfate (CAS 1215683-02-5) is a chemical compound with the molecular formula C9H6O6S and a molecular weight of 247.24 g/mol. IUPAC name: (3,4,5,6,8-pentadeuterio-2-oxochromen-7-yl) hydrogen sulfate. InChIKey: LJOOSFYJELZGMR-RALIUCGRSA-N.
| Molecular formula | C9H6O6S |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (3,4,5,6,8-pentadeuterio-2-oxochromen-7-yl) hydrogen sulfate |
| InChIKey | LJOOSFYJELZGMR-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1C(=C(C(=O)O2)[2H])[2H])[2H])OS(=O)(=O)O)[2H] |
Computed by PubChem (NCBI)