CAS 1215691-72-7 is the registry number for Clozapine-d3. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
3-chloro-6-[4-(trideuteriomethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine (CAS 1215691-72-7) is a chemical compound with the molecular formula C18H19ClN4 and a molecular weight of 329.8 g/mol. IUPAC name: 3-chloro-6-[4-(trideuteriomethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine. InChIKey: QZUDBNBUXVUHMW-FIBGUPNXSA-N.
| Molecular formula | C18H19ClN4 |
|---|---|
| Molecular weight | 329.8 g/mol |
| IUPAC name | 3-chloro-6-[4-(trideuteriomethyl)piperazin-1-yl]-11H-benzo[b][1,4]benzodiazepine |
| InChIKey | QZUDBNBUXVUHMW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=NC3=C(C=CC(=C3)Cl)NC4=CC=CC=C42 |
Computed by PubChem (NCBI)