Products 121571-93-5
CAS 121571-93-5 is the registry number for 2,5-Dimethylfuran-d6, >95% (GC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg.
3,4-dideuterio-2-(deuteriomethyl)-5-(trideuteriomethyl)furan (CAS 121571-93-5) is a chemical compound with the molecular formula C6H8O and a molecular weight of 102.16 g/mol. IUPAC name: 3,4-dideuterio-2-(deuteriomethyl)-5-(trideuteriomethyl)furan. InChIKey: GSNUFIFRDBKVIE-SPDFDVHRSA-N.
| Molecular formula | C6H8O |
|---|---|
| Molecular weight | 102.16 g/mol |
| IUPAC name | 3,4-dideuterio-2-(deuteriomethyl)-5-(trideuteriomethyl)furan |
| InChIKey | GSNUFIFRDBKVIE-SPDFDVHRSA-N |
| SMILES | [2H]CC1=C(C(=C(O1)C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)