CAS 1215713-33-9 is the registry number for 4-(1,4-Diazepan-1-yl)-7-fluoropyrrolo[1,2-a]quinoxaline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(1,4-diazepan-1-yl)-7-fluoropyrrolo[1,2-a]quinoxaline;hydrochloride (CAS 1215713-33-9) is a chemical compound with the molecular formula C16H18ClFN4 and a molecular weight of 320.79 g/mol. IUPAC name: 4-(1,4-diazepan-1-yl)-7-fluoropyrrolo[1,2-a]quinoxaline;hydrochloride. InChIKey: JNGZJCTXAANYQJ-UHFFFAOYSA-N.
| Molecular formula | C16H18ClFN4 |
|---|---|
| Molecular weight | 320.79 g/mol |
| IUPAC name | 4-(1,4-diazepan-1-yl)-7-fluoropyrrolo[1,2-a]quinoxaline;hydrochloride |
| InChIKey | JNGZJCTXAANYQJ-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC3=C(C=CC(=C3)F)N4C2=CC=C4.Cl |
Computed by PubChem (NCBI)