CAS 1215731-50-2 appears in our catalog under these names: 5-Acetoxymethyl-2-furaldehyde-13C6, (5-Formylfuran-2-yl)methyl acetate-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
[5-(oxo(113C)methyl)(2,3,4,5-13C4)furan-2-yl](113C)methyl acetate (CAS 1215731-50-2) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 174.10 g/mol. IUPAC name: [5-(oxo(113C)methyl)(2,3,4,5-13C4)furan-2-yl](113C)methyl acetate. InChIKey: QAVITTVTXPZTSE-CLQMYPOBSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | [5-(oxo(113C)methyl)(2,3,4,5-13C4)furan-2-yl](113C)methyl acetate |
| InChIKey | QAVITTVTXPZTSE-CLQMYPOBSA-N |
| SMILES | CC(=O)O[13CH2][13C]1=[13CH][13CH]=[13C](O1)[13CH]=O |
Computed by PubChem (NCBI)