CAS 121577-32-0 appears in our catalog under these names: Gatifloxacin hydrochloride, 95%, Gatifloxacin hydrochloride/ 99.85% (existing batch purity), Gatifloxacin hydrochloride, Gatifloxacin hydrochloride, Gatifloxacin HCl 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 100mg, 5mg, 10g, 1mg.
1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride (CAS 121577-32-0) is a chemical compound with the molecular formula C19H23ClFN3O4 and a molecular weight of 411.9 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride. InChIKey: GQYBNVXJQVIRGC-UHFFFAOYSA-N.
| Molecular formula | C19H23ClFN3O4 |
|---|---|
| Molecular weight | 411.9 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | GQYBNVXJQVIRGC-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F.Cl |
Computed by PubChem (NCBI)