Products 1215770-73-2
CAS 1215770-73-2 appears in our catalog under these names: Cyclamic Acid-d11, Cyclamic-d11 Acid (cyclohexyl-d11), 99 atom % D, min 98% Chemical Purity, Cyclamic Acid–d11, Cyclamic Acid-d11, 99.90%, D11-Cyclamate, Concentration: 100 µg/ml Solvent: Water. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 1 mg, 1x1ml.
(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)sulfamic acid (CAS 1215770-73-2) is a chemical compound with the molecular formula C6H13NO3S and a molecular weight of 190.31 g/mol. IUPAC name: (1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)sulfamic acid. InChIKey: HCAJEUSONLESMK-KAFHOZLVSA-N.
| Molecular formula | C6H13NO3S |
|---|---|
| Molecular weight | 190.31 g/mol |
| IUPAC name | (1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)sulfamic acid |
| InChIKey | HCAJEUSONLESMK-KAFHOZLVSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])NS(=O)(=O)O)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)