Products 1215798-00-7
CAS 1215798-00-7 is the registry number for N-Despropyl Ropinirole-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
4-[2-(3,3,3-trideuteriopropylamino)ethyl]-1,3-dihydroindol-2-one (CAS 1215798-00-7) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 221.31 g/mol. IUPAC name: 4-[2-(3,3,3-trideuteriopropylamino)ethyl]-1,3-dihydroindol-2-one. InChIKey: VKDWFHAQOZYATG-FIBGUPNXSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 221.31 g/mol |
| IUPAC name | 4-[2-(3,3,3-trideuteriopropylamino)ethyl]-1,3-dihydroindol-2-one |
| InChIKey | VKDWFHAQOZYATG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCNCCC1=C2CC(=O)NC2=CC=C1 |
Computed by PubChem (NCBI)