CAS 1215799-39-5 is the registry number for 5-Benzyloxy Omeprazole. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-phenylmethoxy-1H-benzimidazole (CAS 1215799-39-5) is a chemical compound with the molecular formula C23H23N3O3S and a molecular weight of 421.5 g/mol. IUPAC name: 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-phenylmethoxy-1H-benzimidazole. InChIKey: ZUFHBARHZCYCPS-UHFFFAOYSA-N.
| Molecular formula | C23H23N3O3S |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-phenylmethoxy-1H-benzimidazole |
| InChIKey | ZUFHBARHZCYCPS-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)