CAS 1215841-95-4 is the registry number for Etymemazine-d6. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 10mg, 50mg.
3-(2-ethylphenothiazin-10-yl)-2-methyl-N,N-bis(trideuteriomethyl)propan-1-amine (CAS 1215841-95-4) is a chemical compound with the molecular formula C20H26N2S and a molecular weight of 332.5 g/mol. IUPAC name: 3-(2-ethylphenothiazin-10-yl)-2-methyl-N,N-bis(trideuteriomethyl)propan-1-amine. InChIKey: USKHCLAXJXCWMO-LIJFRPJRSA-N.
| Molecular formula | C20H26N2S |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | 3-(2-ethylphenothiazin-10-yl)-2-methyl-N,N-bis(trideuteriomethyl)propan-1-amine |
| InChIKey | USKHCLAXJXCWMO-LIJFRPJRSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(C)CN1C2=CC=CC=C2SC3=C1C=C(C=C3)CC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)