CAS 1215853-86-3 is the registry number for 2–Azido–3,7,8–trimethyl–3H–imidazo(4,5–f)quinoxaline–d3. Offered by: GLPBio. Available pack sizes: 50mg.
2-azido-7,8-dimethyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoxaline (CAS 1215853-86-3) is a chemical compound with the molecular formula C12H11N7 and a molecular weight of 256.28 g/mol. IUPAC name: 2-azido-7,8-dimethyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoxaline. InChIKey: IJDGZXLRDRKKGV-HPRDVNIFSA-N.
| Molecular formula | C12H11N7 |
|---|---|
| Molecular weight | 256.28 g/mol |
| IUPAC name | 2-azido-7,8-dimethyl-3-(trideuteriomethyl)imidazo[4,5-f]quinoxaline |
| InChIKey | IJDGZXLRDRKKGV-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C3=NC(=C(N=C3C=C2)C)C)N=C1N=[N+]=[N-] |
Computed by PubChem (NCBI)