CAS 1215916-51-0 is the registry number for 2-N-Benzyl-5-bromopyridine-2,3-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-N-benzyl-5-bromopyridine-2,3-diamine (CAS 1215916-51-0) is a chemical compound with the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. IUPAC name: 2-N-benzyl-5-bromopyridine-2,3-diamine. InChIKey: PRPNJRHVYRAKKG-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN3 |
|---|---|
| Molecular weight | 278.15 g/mol |
| IUPAC name | 2-N-benzyl-5-bromopyridine-2,3-diamine |
| InChIKey | PRPNJRHVYRAKKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=C(C=N2)Br)N |
Computed by PubChem (NCBI)