Products 1215953-19-7
CAS 1215953-19-7 appears in our catalog under these names: 6-Bromo-2,3,8-trimethylimidazo(1,2-a)pyridine, 6-Bromo-2,3,8-trimethylimidazo[1,2-a]pyridine, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
6-bromo-2,3,8-trimethylimidazo[1,2-a]pyridine (CAS 1215953-19-7) is a chemical compound with the molecular formula C10H11BrN2 and a molecular weight of 239.11 g/mol. IUPAC name: 6-bromo-2,3,8-trimethylimidazo[1,2-a]pyridine. InChIKey: REVPKIBATBQTRS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2 |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 6-bromo-2,3,8-trimethylimidazo[1,2-a]pyridine |
| InChIKey | REVPKIBATBQTRS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NC(=C2C)C)Br |
Computed by PubChem (NCBI)