CAS 1216027-34-7 is the registry number for 5-Amino-3-bromo-2-(N,N-diethylamino)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-2-N,2-N-diethylpyridine-2,5-diamine (CAS 1216027-34-7) is a chemical compound with the molecular formula C9H14BrN3 and a molecular weight of 244.13 g/mol. IUPAC name: 3-bromo-2-N,2-N-diethylpyridine-2,5-diamine. InChIKey: OXBMBNHITDAFRE-UHFFFAOYSA-N.
| Molecular formula | C9H14BrN3 |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | 3-bromo-2-N,2-N-diethylpyridine-2,5-diamine |
| InChIKey | OXBMBNHITDAFRE-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C=C(C=N1)N)Br |
Computed by PubChem (NCBI)