Products 1216147-31-7

CAS 1216147-31-7 is the registry number for 5-Fluoro-2-(propan-2-yloxy)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

5-fluoro-2-propan-2-yloxybenzenesulfonyl chloride (CAS 1216147-31-7) is a chemical compound with the molecular formula C9H10ClFO3S and a molecular weight of 252.69 g/mol. IUPAC name: 5-fluoro-2-propan-2-yloxybenzenesulfonyl chloride. InChIKey: CXPQORTYFWWSDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClFO3S
Molecular weight252.69 g/mol
IUPAC name5-fluoro-2-propan-2-yloxybenzenesulfonyl chloride
InChIKeyCXPQORTYFWWSDZ-UHFFFAOYSA-N
SMILESCC(C)OC1=C(C=C(C=C1)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)