Products 121617-11-6
CAS 121617-11-6 appears in our catalog under these names: Saviprazole, 96.05%, Saviprazole. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 10 mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfinyl]-1H-thieno[3,4-d]imidazole (CAS 121617-11-6) is a chemical compound with the molecular formula C15H10F7N3O2S2 and a molecular weight of 461.4 g/mol. IUPAC name: 2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfinyl]-1H-thieno[3,4-d]imidazole. InChIKey: ARFGGIRJBPTBPP-UHFFFAOYSA-N.
| Molecular formula | C15H10F7N3O2S2 |
|---|---|
| Molecular weight | 461.4 g/mol |
| IUPAC name | 2-[[4-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-pyridinyl]methylsulfinyl]-1H-thieno[3,4-d]imidazole |
| InChIKey | ARFGGIRJBPTBPP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1OCC(C(C(F)(F)F)(F)F)(F)F)CS(=O)C2=NC3=CSC=C3N2 |
Computed by PubChem (NCBI)