CAS 1216310-09-6 is the registry number for 5-Bromo-2-(ethylsulfonyl)pyrimidine-4-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-2-ethylsulfonylpyrimidine-4-carboxylic acid (CAS 1216310-09-6) is a chemical compound with the molecular formula C7H7BrN2O4S and a molecular weight of 295.11 g/mol. IUPAC name: 5-bromo-2-ethylsulfonylpyrimidine-4-carboxylic acid. InChIKey: ZVYDZAGLYCCPOW-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O4S |
|---|---|
| Molecular weight | 295.11 g/mol |
| IUPAC name | 5-bromo-2-ethylsulfonylpyrimidine-4-carboxylic acid |
| InChIKey | ZVYDZAGLYCCPOW-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=NC=C(C(=N1)C(=O)O)Br |
Computed by PubChem (NCBI)