CAS 1216387-74-4 appears in our catalog under these names: tert-Butyl 4-benzylpiperazine-1-carboxylate-d8, N’-Boc-N-Benzylpiperazine-d8. Offered by: MedChemExpress, TRC. Available pack sizes: 10 mg, 5 mg, 50 mg, 100mg, 10mg.
Tert-butyl 4-benzyl-2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate (CAS 1216387-74-4) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 284.42 g/mol. IUPAC name: tert-butyl 4-benzyl-2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate. InChIKey: GVHSMUYEAWMYLM-PMCMNDOISA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 284.42 g/mol |
| IUPAC name | tert-butyl 4-benzyl-2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate |
| InChIKey | GVHSMUYEAWMYLM-PMCMNDOISA-N |
| SMILES | [2H]C1(C(N(C(C(N1CC2=CC=CC=C2)([2H])[2H])([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)