CAS 1216413-92-1 appears in our catalog under these names: Pentaerythritol-d8 Dibromide, Pentaerythritol dibromide-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
2,2-bis[bromo(dideuterio)methyl]-1,1,3,3-tetradeuteriopropane-1,3-diol (CAS 1216413-92-1) is a chemical compound with the molecular formula C5H10Br2O2 and a molecular weight of 269.99 g/mol. IUPAC name: 2,2-bis[bromo(dideuterio)methyl]-1,1,3,3-tetradeuteriopropane-1,3-diol. InChIKey: CHUGKEQJSLOLHL-SVYQBANQSA-N.
| Molecular formula | C5H10Br2O2 |
|---|---|
| Molecular weight | 269.99 g/mol |
| IUPAC name | 2,2-bis[bromo(dideuterio)methyl]-1,1,3,3-tetradeuteriopropane-1,3-diol |
| InChIKey | CHUGKEQJSLOLHL-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C(C([2H])([2H])O)(C([2H])([2H])Br)C([2H])([2H])Br)O |
Computed by PubChem (NCBI)