Products 1216414-18-4
CAS 1216414-18-4 appears in our catalog under these names: 4-Amino-1-pentanol-d4 Hydrochloride, 4-Amino-1-pentanol-d4 Hydrochloride Salt, 4–Amino–1–pentanol–d4 Hydrochloride Salt. Offered by: MedChemExpress, TRC, GLPBio. Available pack sizes: 5 mg, 50 mg, 50mg, 5mg.
4-amino-1,1,2,2-tetradeuteriopentan-1-ol;hydrochloride (CAS 1216414-18-4) is a chemical compound with the molecular formula C5H14ClNO and a molecular weight of 143.65 g/mol. IUPAC name: 4-amino-1,1,2,2-tetradeuteriopentan-1-ol;hydrochloride. InChIKey: DLOGMTRDVUURIL-WLKDFHKOSA-N.
| Molecular formula | C5H14ClNO |
|---|---|
| Molecular weight | 143.65 g/mol |
| IUPAC name | 4-amino-1,1,2,2-tetradeuteriopentan-1-ol;hydrochloride |
| InChIKey | DLOGMTRDVUURIL-WLKDFHKOSA-N |
| SMILES | [2H]C([2H])(CC(C)N)C([2H])([2H])O.Cl |
Computed by PubChem (NCBI)