CAS 1216468-48-2 appears in our catalog under these names: Homogentisic Acid-13C6, 98% 98%atom%13C, Homogentisic Acid-13C6, >95% (HPLC), Homogentisic acid-13C6. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2mg, 5mg, 25mg, 5 mg, 1 mg.
2-(2,5-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid (CAS 1216468-48-2) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 174.10 g/mol. IUPAC name: 2-(2,5-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid. InChIKey: IGMNYECMUMZDDF-JTZKEMBVSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2-(2,5-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetic acid |
| InChIKey | IGMNYECMUMZDDF-JTZKEMBVSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1O)CC(=O)O)O |
Computed by PubChem (NCBI)