Products 1216475-83-0
CAS 1216475-83-0 appears in our catalog under these names: Ethyl Isobutyrylacetate-d6, Ethyl 4-methyl-3-oxopentanoate-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 50mg, 25 mg, 50 mg, 500 mg, 100 mg.
Ethyl 5,5,5-trideuterio-3-oxo-4-(trideuteriomethyl)pentanoate (CAS 1216475-83-0) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 164.23 g/mol. IUPAC name: ethyl 5,5,5-trideuterio-3-oxo-4-(trideuteriomethyl)pentanoate. InChIKey: XCLDSQRVMMXWMS-XERRXZQWSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 164.23 g/mol |
| IUPAC name | ethyl 5,5,5-trideuterio-3-oxo-4-(trideuteriomethyl)pentanoate |
| InChIKey | XCLDSQRVMMXWMS-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)CC(=O)OCC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)