CAS 1216512-47-8 is the registry number for Demethylchloro citalopram hydrochloride. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
1-(4-chlorophenyl)-1-[3-(methylamino)propyl]-3H-2-benzofuran-5-carbonitrile;hydrochloride (CAS 1216512-47-8) is a chemical compound with the molecular formula C19H20Cl2N2O and a molecular weight of 363.3 g/mol. IUPAC name: 1-(4-chlorophenyl)-1-[3-(methylamino)propyl]-3H-2-benzofuran-5-carbonitrile;hydrochloride. InChIKey: QMEHNDJVEDFNAT-UHFFFAOYSA-N.
| Molecular formula | C19H20Cl2N2O |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-1-[3-(methylamino)propyl]-3H-2-benzofuran-5-carbonitrile;hydrochloride |
| InChIKey | QMEHNDJVEDFNAT-UHFFFAOYSA-N |
| SMILES | CNCCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)