CAS 1216515-97-7 is the registry number for 4-Chloro-2-nitroaniline-d3. Offered by: TRC. Available pack sizes: 25mg.
4-chloro-2,3,5-trideuterio-6-nitroaniline (CAS 1216515-97-7) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 175.59 g/mol. IUPAC name: 4-chloro-2,3,5-trideuterio-6-nitroaniline. InChIKey: PBGKNXWGYQPUJK-CBYSEHNBSA-N.
| Molecular formula | C6H5ClN2O2 |
|---|---|
| Molecular weight | 175.59 g/mol |
| IUPAC name | 4-chloro-2,3,5-trideuterio-6-nitroaniline |
| InChIKey | PBGKNXWGYQPUJK-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[N+](=O)[O-])[2H])Cl)[2H] |
Computed by PubChem (NCBI)