CAS 1216522-89-2 appears in our catalog under these names: Metoclopramide-d3, Metoclopramide-d3, >95% (HPLC), Metoclopramide–d3. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 50mg, 5mg, 500μg, 1mg, 500 μg.
4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide (CAS 1216522-89-2) is a chemical compound with the molecular formula C14H22ClN3O2 and a molecular weight of 302.81 g/mol. IUPAC name: 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide. InChIKey: TTWJBBZEZQICBI-HPRDVNIFSA-N.
| Molecular formula | C14H22ClN3O2 |
|---|---|
| Molecular weight | 302.81 g/mol |
| IUPAC name | 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-(trideuteriomethoxy)benzamide |
| InChIKey | TTWJBBZEZQICBI-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1C(=O)NCCN(CC)CC)Cl)N |
Computed by PubChem (NCBI)