CAS 1216548-20-7 appears in our catalog under these names: 7-Chloro Epinastine HCl, Epinastine Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
16-chloro-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,7,9,11,15,17-heptaen-3-amine;hydrochloride (CAS 1216548-20-7) is a chemical compound with the molecular formula C16H15Cl2N3 and a molecular weight of 320.2 g/mol. IUPAC name: 16-chloro-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,7,9,11,15,17-heptaen-3-amine;hydrochloride. InChIKey: SKQNTLALARIPLX-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl2N3 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | 16-chloro-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,7,9,11,15,17-heptaen-3-amine;hydrochloride |
| InChIKey | SKQNTLALARIPLX-UHFFFAOYSA-N |
| SMILES | C1C2C3=CC=CC=C3CC4=C(N2C(=N1)N)C=CC(=C4)Cl.Cl |
Computed by PubChem (NCBI)