CAS 1216563-75-5 is the registry number for (1-(3,4-Dimethoxybenzenesulfonyl)piperidin-4-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[1-(3,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride (CAS 1216563-75-5) is a chemical compound with the molecular formula C14H23ClN2O4S and a molecular weight of 350.9 g/mol. IUPAC name: [1-(3,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride. InChIKey: PDZIDLGPAOSHJC-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O4S |
|---|---|
| Molecular weight | 350.9 g/mol |
| IUPAC name | [1-(3,4-dimethoxyphenyl)sulfonylpiperidin-4-yl]methanamine;hydrochloride |
| InChIKey | PDZIDLGPAOSHJC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N2CCC(CC2)CN)OC.Cl |
Computed by PubChem (NCBI)