CAS 121659-86-7 appears in our catalog under these names: Pitavastatin Impurity 32, 4-(4-Fluorophenyl)-2-cyclopropylquinoline-3-carboxylic Acid Methyl Ester, >95% (HPLC), Methyl 2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinecarboxylate. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 100mg, 50mg, 4x25mg, 25mg.
Methyl 2-cyclopropyl-4-(4-fluorophenyl)quinoline-3-carboxylate (CAS 121659-86-7) is a chemical compound with the molecular formula C20H16FNO2 and a molecular weight of 321.3 g/mol. IUPAC name: methyl 2-cyclopropyl-4-(4-fluorophenyl)quinoline-3-carboxylate. InChIKey: RNXQZVFWKIPEOJ-UHFFFAOYSA-N.
| Molecular formula | C20H16FNO2 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | methyl 2-cyclopropyl-4-(4-fluorophenyl)quinoline-3-carboxylate |
| InChIKey | RNXQZVFWKIPEOJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2N=C1C3CC3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)