CAS 1216605-57-0 is the registry number for Naled-d6. Offered by: TRC. Available pack sizes: 50mg, 5mg.
(1,2-dibromo-2,2-dichloroethyl) bis(trideuteriomethyl) phosphate (CAS 1216605-57-0) is a chemical compound with the molecular formula C4H7Br2Cl2O4P and a molecular weight of 386.82 g/mol. IUPAC name: (1,2-dibromo-2,2-dichloroethyl) bis(trideuteriomethyl) phosphate. InChIKey: BUYMVQAILCEWRR-WFGJKAKNSA-N.
| Molecular formula | C4H7Br2Cl2O4P |
|---|---|
| Molecular weight | 386.82 g/mol |
| IUPAC name | (1,2-dibromo-2,2-dichloroethyl) bis(trideuteriomethyl) phosphate |
| InChIKey | BUYMVQAILCEWRR-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OP(=O)(OC(C(Cl)(Cl)Br)Br)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)