CAS 1216608-24-0 appears in our catalog under these names: Cyamemazine-d6, >95% (HPLC), Cyamemazine-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
10-[3-[bis(trideuteriomethyl)amino]-2-methylpropyl]phenothiazine-2-carbonitrile (CAS 1216608-24-0) is a chemical compound with the molecular formula C19H21N3S and a molecular weight of 329.5 g/mol. IUPAC name: 10-[3-[bis(trideuteriomethyl)amino]-2-methylpropyl]phenothiazine-2-carbonitrile. InChIKey: SLFGIOIONGJGRT-XERRXZQWSA-N.
| Molecular formula | C19H21N3S |
|---|---|
| Molecular weight | 329.5 g/mol |
| IUPAC name | 10-[3-[bis(trideuteriomethyl)amino]-2-methylpropyl]phenothiazine-2-carbonitrile |
| InChIKey | SLFGIOIONGJGRT-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(C)CN1C2=CC=CC=C2SC3=C1C=C(C=C3)C#N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)