CAS 1216616-31-7 appears in our catalog under these names: 5-Fluoro Cytosine-13C,15N2, >95% (HPLC), Flucytosine–13C,15N2, Flucytosine-13C,15N2, 98.06%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
6-amino-5-fluoro-(213C,1,3-15N2)1H-pyrimidin-2-one (CAS 1216616-31-7) is a chemical compound with the molecular formula C4H4FN3O and a molecular weight of 132.07 g/mol. IUPAC name: 6-amino-5-fluoro-(213C,1,3-15N2)1H-pyrimidin-2-one. InChIKey: XRECTZIEBJDKEO-DPZTXFNWSA-N.
| Molecular formula | C4H4FN3O |
|---|---|
| Molecular weight | 132.07 g/mol |
| IUPAC name | 6-amino-5-fluoro-(213C,1,3-15N2)1H-pyrimidin-2-one |
| InChIKey | XRECTZIEBJDKEO-DPZTXFNWSA-N |
| SMILES | C1=[15N][13C](=O)[15NH]C(=C1F)N |
Computed by PubChem (NCBI)