Products 1216619-20-3
CAS 1216619-20-3 appears in our catalog under these names: N-Acetyl Desethyl Chloroquine-d4, N-Acetyl Desethyl Chloroquine-d4, >95% (HPLC), N–acetyl Desethylchloroquine–d4, N-Acetyl(mono)desethylchloroquine-d4. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 500μg, 5 mg, 1 mg.
N-[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-N-ethylacetamide (CAS 1216619-20-3) is a chemical compound with the molecular formula C18H24ClN3O and a molecular weight of 337.9 g/mol. IUPAC name: N-[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-N-ethylacetamide. InChIKey: HGDLFXICTKRYJP-LHJLJATRSA-N.
| Molecular formula | C18H24ClN3O |
|---|---|
| Molecular weight | 337.9 g/mol |
| IUPAC name | N-[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-N-ethylacetamide |
| InChIKey | HGDLFXICTKRYJP-LHJLJATRSA-N |
| SMILES | [2H]C([2H])(CC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)C([2H])([2H])N(CC)C(=O)C |
Computed by PubChem (NCBI)