CAS 1216626-17-3 appears in our catalog under these names: Amisulpride-d5, Amisulpride-d5, >95% (HPLC), Amisulpride–d5, Amisulpride-d5, 98.27%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Sigma-Aldrich. Available pack sizes: on request, 10mg, 1mg, 5mg, 1ML, 5 mg, 1 mg, 10 mg.
4-amino-5-ethylsulfonyl-2-methoxy-N-[[1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidin-2-yl]methyl]benzamide (CAS 1216626-17-3) is a chemical compound with the molecular formula C17H27N3O4S and a molecular weight of 374.5 g/mol. IUPAC name: 4-amino-5-ethylsulfonyl-2-methoxy-N-[[1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidin-2-yl]methyl]benzamide. InChIKey: NTJOBXMMWNYJFB-SGEUAGPISA-N.
| Molecular formula | C17H27N3O4S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 4-amino-5-ethylsulfonyl-2-methoxy-N-[[1-(1,1,2,2,2-pentadeuterioethyl)pyrrolidin-2-yl]methyl]benzamide |
| InChIKey | NTJOBXMMWNYJFB-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N1CCCC1CNC(=O)C2=CC(=C(C=C2OC)N)S(=O)(=O)CC |
Computed by PubChem (NCBI)