CAS 1216633-22-5 is the registry number for 4-Amino-2,6-dimethyl-7(8H)-pteridone Sodium Salt. Offered by: TRC. Available pack sizes: 250mg, 25mg.
Sodium 4-amino-2,6-dimethylpteridin-7-olate (CAS 1216633-22-5) is a chemical compound with the molecular formula C8H8N5NaO and a molecular weight of 213.17 g/mol. IUPAC name: sodium 4-amino-2,6-dimethylpteridin-7-olate. InChIKey: WRJDYOONLYLBKB-UHFFFAOYSA-M.
| Molecular formula | C8H8N5NaO |
|---|---|
| Molecular weight | 213.17 g/mol |
| IUPAC name | sodium 4-amino-2,6-dimethylpteridin-7-olate |
| InChIKey | WRJDYOONLYLBKB-UHFFFAOYSA-M |
| SMILES | CC1=C(N=C2C(=N1)C(=NC(=N2)C)N)[O-].[Na+] |
Computed by PubChem (NCBI)