CAS 1216649-31-8 appears in our catalog under these names: 2-Amino-4-(isopropyl-d7-amino)-6-chloro-triazine, >95% (HPLC), Desethylatrazine-d7 (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, 2–Amino–4–(isopropyl–d7–amino)–6–chloro–triazine, Desethylatrazine–d7, 2-Amino-4-(isopropyl-d7-amino)-6-chloro-triazine. Offered by: TRC, CDN, GLPBio, Biosynth, HPC Standards. Available pack sizes: 1mg, 2,5mg, 0,05g, 0,01g, 50mg, 5mg, 10mg, 25mg.
6-chloro-2-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine (CAS 1216649-31-8) is a chemical compound with the molecular formula C6H10ClN5 and a molecular weight of 194.67 g/mol. IUPAC name: 6-chloro-2-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine. InChIKey: DFWFIQKMSFGDCQ-YYWVXINBSA-N.
| Molecular formula | C6H10ClN5 |
|---|---|
| Molecular weight | 194.67 g/mol |
| IUPAC name | 6-chloro-2-N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine |
| InChIKey | DFWFIQKMSFGDCQ-YYWVXINBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC1=NC(=NC(=N1)N)Cl |
Computed by PubChem (NCBI)