Products 1216666-53-3
CAS 1216666-53-3 appears in our catalog under these names: 4-Amino-1-pentanol-d4, 4–Amino–1–pentanol–d4. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 250mg, 50mg, 5mg, 100mg, 50 mg, 250 mg, 10 mg.
4-amino-1,1,2,2-tetradeuteriopentan-1-ol (CAS 1216666-53-3) is a chemical compound with the molecular formula C5H13NO and a molecular weight of 107.19 g/mol. IUPAC name: 4-amino-1,1,2,2-tetradeuteriopentan-1-ol. InChIKey: JAXJUENAJXWFBX-BYUTVXSXSA-N.
| Molecular formula | C5H13NO |
|---|---|
| Molecular weight | 107.19 g/mol |
| IUPAC name | 4-amino-1,1,2,2-tetradeuteriopentan-1-ol |
| InChIKey | JAXJUENAJXWFBX-BYUTVXSXSA-N |
| SMILES | [2H]C([2H])(CC(C)N)C([2H])([2H])O |
Computed by PubChem (NCBI)