Products 1216682-38-0
CAS 1216682-38-0 appears in our catalog under these names: Lansoprazole Sulfide-d4, >95% (HPLC), Lansoprazole Sulfide D4, Lansoprazole Sulfide D4, Lansoprazole sulfide-d4, 99.0%. Offered by: TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 1mg, 5mg, 1 mg, 5 mg.
4,5,6,7-tetradeuterio-2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (CAS 1216682-38-0) is a chemical compound with the molecular formula C16H14F3N3OS and a molecular weight of 357.4 g/mol. IUPAC name: 4,5,6,7-tetradeuterio-2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole. InChIKey: CCHLMSUZHFPSFC-QFFDRWTDSA-N.
| Molecular formula | C16H14F3N3OS |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4,5,6,7-tetradeuterio-2-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| InChIKey | CCHLMSUZHFPSFC-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])NC(=N2)SCC3=NC=CC(=C3C)OCC(F)(F)F)[2H])[2H] |
Computed by PubChem (NCBI)