Products 1216685-32-3
CAS 1216685-32-3 appears in our catalog under these names: Bumetanide-d5 Butyl Ester, >95% (HPLC), Bumetanide-d5 Butyl Ester. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
Butyl 3-(butylamino)-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoate (CAS 1216685-32-3) is a chemical compound with the molecular formula C21H28N2O5S and a molecular weight of 425.6 g/mol. IUPAC name: butyl 3-(butylamino)-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoate. InChIKey: FUBXAOXPLXHBPG-RAGZBHKVSA-N.
| Molecular formula | C21H28N2O5S |
|---|---|
| Molecular weight | 425.6 g/mol |
| IUPAC name | butyl 3-(butylamino)-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoate |
| InChIKey | FUBXAOXPLXHBPG-RAGZBHKVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC2=C(C=C(C=C2S(=O)(=O)N)C(=O)OCCCC)NCCCC)[2H])[2H] |
Computed by PubChem (NCBI)