CAS 1216715-80-8 appears in our catalog under these names: Amiodarone-d4 HCl, Amiodarone-d4 Hydrochloride, >95% (HPLC), Amiodarone-d4 HCl (ethoxy-d4), 99 atom % D, min 98% Chemical Purity, Amiodarone–d4 (hydrochloride), Amiodarone-d4 (hydrochloride), 99.58%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 0,01g, 0,005g, 1mg, 5mg, 5 mg.
(2-butyl-1-benzofuran-3-yl)-[3,5-diiodo-4-[1,1,2,2-tetradeuterio-2-(diethylamino)ethoxy]phenyl]methanone;hydrochloride (CAS 1216715-80-8) is a chemical compound with the molecular formula C25H30ClI2NO3 and a molecular weight of 685.8 g/mol. IUPAC name: (2-butyl-1-benzofuran-3-yl)-[3,5-diiodo-4-[1,1,2,2-tetradeuterio-2-(diethylamino)ethoxy]phenyl]methanone;hydrochloride. InChIKey: ITPDYQOUSLNIHG-MMJSDMDPSA-N.
| Molecular formula | C25H30ClI2NO3 |
|---|---|
| Molecular weight | 685.8 g/mol |
| IUPAC name | (2-butyl-1-benzofuran-3-yl)-[3,5-diiodo-4-[1,1,2,2-tetradeuterio-2-(diethylamino)ethoxy]phenyl]methanone;hydrochloride |
| InChIKey | ITPDYQOUSLNIHG-MMJSDMDPSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC1=C(C=C(C=C1I)C(=O)C2=C(OC3=CC=CC=C32)CCCC)I)N(CC)CC.Cl |
Computed by PubChem (NCBI)