CAS 1216720-69-2 appears in our catalog under these names: SCH 79797 Dihydrochloride, SCH79797 dihydrochloride/ 98.58% (existing batch purity), SCH 79797 dihydrochloride, SCH79797 dihydrochloride, SCH79797 2HCl 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg.
3-N-cyclopropyl-7-[(4-propan-2-ylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine;dihydrochloride (CAS 1216720-69-2) is a chemical compound with the molecular formula C23H27Cl2N5 and a molecular weight of 444.4 g/mol. IUPAC name: 3-N-cyclopropyl-7-[(4-propan-2-ylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine;dihydrochloride. InChIKey: NNJTXSQXGHYXAJ-UHFFFAOYSA-N.
| Molecular formula | C23H27Cl2N5 |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | 3-N-cyclopropyl-7-[(4-propan-2-ylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine;dihydrochloride |
| InChIKey | NNJTXSQXGHYXAJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CN2C=CC3=C2C=CC4=C3C(=NC(=N4)NC5CC5)N.Cl.Cl |
Computed by PubChem (NCBI)