CAS 1216764-05-4 appears in our catalog under these names: Epichlorohydrin Impurity 4-d5, 2-Chloro-1,3-propanediol-d5 (Major) (10 ug/ml in Methanol), 2-Chloro-1,3-propanediol-d5 (Major), >95% (GC), 2-Chloro-1,3-propanediol-d5, >95% (GC), 2–Chloro–1,3–propanediol–d5. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 20x1ml, 1mg, 2,5mg, 25mg, 5mg, 2mg, 10mg.
2-chloro-1,1,2,3,3-pentadeuteriopropane-1,3-diol (CAS 1216764-05-4) is a chemical compound with the molecular formula C3H7ClO2 and a molecular weight of 115.57 g/mol. IUPAC name: 2-chloro-1,1,2,3,3-pentadeuteriopropane-1,3-diol. InChIKey: DYPJJAAKPQKWTM-UXXIZXEISA-N.
| Molecular formula | C3H7ClO2 |
|---|---|
| Molecular weight | 115.57 g/mol |
| IUPAC name | 2-chloro-1,1,2,3,3-pentadeuteriopropane-1,3-diol |
| InChIKey | DYPJJAAKPQKWTM-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])O)Cl)O |
Computed by PubChem (NCBI)