Products 1216770-08-9
CAS 1216770-08-9 appears in our catalog under these names: Nabumetone-d3, >95% (HPLC), Nabumetone-d3 (methoxy-d3), 99 atom % D, min 98% Chemical Purity, Nabumetone–d3, Nabumetone-d3, 98.80%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 0,01g, 0,005g, 1 mg.
4-[6-(trideuteriomethoxy)naphthalen-2-yl]butan-2-one (CAS 1216770-08-9) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 231.30 g/mol. IUPAC name: 4-[6-(trideuteriomethoxy)naphthalen-2-yl]butan-2-one. InChIKey: BLXXJMDCKKHMKV-BMSJAHLVSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 231.30 g/mol |
| IUPAC name | 4-[6-(trideuteriomethoxy)naphthalen-2-yl]butan-2-one |
| InChIKey | BLXXJMDCKKHMKV-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C=C(C=C2)CCC(=O)C |
Computed by PubChem (NCBI)